C23H44O2 — CID 151684910
4-(3-ethylpentan-3-yl)dodecyl 2-methylprop-2-enoate (PubChem CID 151684910) has the molecular formula C23H44O2 and a molecular weight of 352.60 g/mol. Its IUPAC name is 4-(3-ethylpentan-3-yl)dodecyl 2-methylprop-2-enoate.
| Compound Name | 4-(3-ethylpentan-3-yl)dodecyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 151684910 |
| Molecular Formula | C23H44O2 |
| Molecular Weight | 352.60 g/mol |
| Exact Mass | 352.33 |
| IUPAC Name | 4-(3-ethylpentan-3-yl)dodecyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCC(CCCCCCCC)C(CC)(CC)CC |
| InChI | InChI=1S/C23H44O2/c1-7-11-12-13-14-15-17-21(23(8-2,9-3)10-4)18-16-19-25-22(24)20(5)6/h21H,5,7-19H2,1-4,6H3 |
| InChIKey | RBHZUJNTFLCKHF-UHFFFAOYSA-N |
| XLogP | 7.47 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.60 |
| LogP ≤ 5 | 7.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|