C20H39NO2 — CID 102118110
6-(dipropylamino)decyl 2-methylprop-2-enoate (PubChem CID 102118110) has the molecular formula C20H39NO2 and a molecular weight of 325.54 g/mol. Its IUPAC name is 6-(dipropylamino)decyl 2-methylprop-2-enoate.
| Compound Name | 6-(dipropylamino)decyl 2-methylprop-2-enoate |
|---|---|
| PubChem CID | 102118110 |
| Molecular Formula | C20H39NO2 |
| Molecular Weight | 325.54 g/mol |
| Exact Mass | 325.30 |
| IUPAC Name | 6-(dipropylamino)decyl 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OCCCCCC(CCCC)N(CCC)CCC |
| InChI | InChI=1S/C20H39NO2/c1-6-9-13-19(21(15-7-2)16-8-3)14-11-10-12-17-23-20(22)18(4)5/h19H,4,6-17H2,1-3,5H3 |
| InChIKey | WFVSSVCJWXQKNI-UHFFFAOYSA-N |
| XLogP | 5.35 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.54 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|