C9H20O5S3 — CID 18006043
2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-tris(sulfanyl)propanoic acid (PubChem CID 18006043) has the molecular formula C9H20O5S3 and a molecular weight of 304.46 g/mol. Its IUPAC name is 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-tris(sulfanyl)propanoic acid.
| Compound Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-tris(sulfanyl)propanoic acid |
|---|---|
| PubChem CID | 18006043 |
| Molecular Formula | C9H20O5S3 |
| Molecular Weight | 304.46 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | 2-ethyl-2-(hydroxymethyl)propane-1,3-diol;2,2,3-tris(sulfanyl)propanoic acid |
| SMILES | CCC(CO)(CO)CO.O=C(O)C(S)(S)CS |
| InChI | InChI=1S/C6H14O3.C3H6O2S3/c1-2-6(3-7,4-8)5-9;4-2(5)3(7,8)1-6/h7-9H,2-5H2,1H3;6-8H,1H2,(H,4,5) |
| InChIKey | FUPVGGPYDZJKRV-UHFFFAOYSA-N |
| XLogP | -0.08 |
| TPSA | 97.99 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.46 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|