C15H24O6 — CID 88762179
2-[2,2-bis(hydroxymethyl)butoxycarbonyl]-2-prop-2-enylpent-4-enoic acid (PubChem CID 88762179) has the molecular formula C15H24O6 and a molecular weight of 300.35 g/mol. Its IUPAC name is 2-[2,2-bis(hydroxymethyl)butoxycarbonyl]-2-prop-2-enylpent-4-enoic acid.
| Compound Name | 2-[2,2-bis(hydroxymethyl)butoxycarbonyl]-2-prop-2-enylpent-4-enoic acid |
|---|---|
| PubChem CID | 88762179 |
| Molecular Formula | C15H24O6 |
| Molecular Weight | 300.35 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 2-[2,2-bis(hydroxymethyl)butoxycarbonyl]-2-prop-2-enylpent-4-enoic acid |
| SMILES | C=CCC(CC=C)(C(=O)O)C(=O)OCC(CC)(CO)CO |
| InChI | InChI=1S/C15H24O6/c1-4-7-15(8-5-2,12(18)19)13(20)21-11-14(6-3,9-16)10-17/h4-5,16-17H,1-2,6-11H2,3H3,(H,18,19) |
| InChIKey | RUSPESXNEOIEOZ-UHFFFAOYSA-N |
| XLogP | 1.13 |
| TPSA | 104.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.35 |
| LogP ≤ 5 | 1.13 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|