C12H14F5NO4Si — CID 90170530
(2,3,4,5,6-pentafluorophenyl) 2-amino-2-[ethyl(dimethoxy)silyl]acetate (PubChem CID 90170530) has the molecular formula C12H14F5NO4Si and a molecular weight of 359.32 g/mol. Its IUPAC name is (2,3,4,5,6-pentafluorophenyl) 2-amino-2-[ethyl(dimethoxy)silyl]acetate.
| Compound Name | (2,3,4,5,6-pentafluorophenyl) 2-amino-2-[ethyl(dimethoxy)silyl]acetate |
|---|---|
| PubChem CID | 90170530 |
| Molecular Formula | C12H14F5NO4Si |
| Molecular Weight | 359.32 g/mol |
| Exact Mass | 359.06 |
| IUPAC Name | (2,3,4,5,6-pentafluorophenyl) 2-amino-2-[ethyl(dimethoxy)silyl]acetate |
| SMILES | CC[Si](OC)(OC)C(N)C(=O)Oc1c(F)c(F)c(F)c(F)c1F |
| InChI | InChI=1S/C12H14F5NO4Si/c1-4-23(20-2,21-3)11(18)12(19)22-10-8(16)6(14)5(13)7(15)9(10)17/h11H,4,18H2,1-3H3 |
| InChIKey | BZERBBZWFZOSFE-UHFFFAOYSA-N |
| XLogP | 1.91 |
| TPSA | 70.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.32 |
| LogP ≤ 5 | 1.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|