C7H10OS2 — CID 71340710
5,5-bis(methylsulfanyl)penta-2,4-dienal (PubChem CID 71340710) has the molecular formula C7H10OS2 and a molecular weight of 174.29 g/mol. Its IUPAC name is 5,5-bis(methylsulfanyl)penta-2,4-dienal.
| Compound Name | 5,5-bis(methylsulfanyl)penta-2,4-dienal |
|---|---|
| PubChem CID | 71340710 |
| Molecular Formula | C7H10OS2 |
| Molecular Weight | 174.29 g/mol |
| Exact Mass | 174.02 |
| IUPAC Name | 5,5-bis(methylsulfanyl)penta-2,4-dienal |
| SMILES | CSC(=CC=CC=O)SC |
| InChI | InChI=1S/C7H10OS2/c1-9-7(10-2)5-3-4-6-8/h3-6H,1-2H3 |
| InChIKey | OEHYLTSBBHSMCW-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.29 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|