C7H12NO+ — CID 59359640
dimethyl-[(1E,3E)-5-oxopenta-1,3-dienyl]azanium (PubChem CID 59359640) has the molecular formula C7H12NO+ and a molecular weight of 126.18 g/mol. Its IUPAC name is dimethyl-[(1E,3E)-5-oxopenta-1,3-dienyl]azanium.
| Compound Name | dimethyl-[(1E,3E)-5-oxopenta-1,3-dienyl]azanium |
|---|---|
| PubChem CID | 59359640 |
| Molecular Formula | C7H12NO+ |
| Molecular Weight | 126.18 g/mol |
| Exact Mass | 126.09 |
| IUPAC Name | dimethyl-[(1E,3E)-5-oxopenta-1,3-dienyl]azanium |
| SMILES | C[NH+](C)/C=C/C=C/C=O |
| InChI | InChI=1S/C7H11NO/c1-8(2)6-4-3-5-7-9/h3-7H,1-2H3/p+1/b5-3+,6-4+ |
| InChIKey | MJPXUXNGHKYZIV-GGWOSOGESA-O |
| XLogP | -0.60 |
| TPSA | 21.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.18 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|