C7H9ClO2 — CID 102371567
(2E,4E)-5-chloro-5-ethoxypenta-2,4-dienal (PubChem CID 102371567) has the molecular formula C7H9ClO2 and a molecular weight of 160.60 g/mol. Its IUPAC name is (2E,4E)-5-chloro-5-ethoxypenta-2,4-dienal.
| Compound Name | (2E,4E)-5-chloro-5-ethoxypenta-2,4-dienal |
|---|---|
| PubChem CID | 102371567 |
| Molecular Formula | C7H9ClO2 |
| Molecular Weight | 160.60 g/mol |
| Exact Mass | 160.03 |
| IUPAC Name | (2E,4E)-5-chloro-5-ethoxypenta-2,4-dienal |
| SMILES | CCO/C(Cl)=C\C=C\C=O |
| InChI | InChI=1S/C7H9ClO2/c1-2-10-7(8)5-3-4-6-9/h3-6H,2H2,1H3/b4-3+,7-5- |
| InChIKey | XDZPCMVRVFBJKP-BZDQXIRASA-N |
| XLogP | 1.86 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 160.60 |
| LogP ≤ 5 | 1.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|