C6H6O3 — CID 89003386
(2Z,4E)-6-oxohexa-2,4-dienoic acid (PubChem CID 89003386) has the molecular formula C6H6O3 and a molecular weight of 126.11 g/mol. Its IUPAC name is (2Z,4E)-6-oxohexa-2,4-dienoic acid.
| Compound Name | (2Z,4E)-6-oxohexa-2,4-dienoic acid |
|---|---|
| PubChem CID | 89003386 |
| Molecular Formula | C6H6O3 |
| Molecular Weight | 126.11 g/mol |
| Exact Mass | 126.03 |
| IUPAC Name | (2Z,4E)-6-oxohexa-2,4-dienoic acid |
| SMILES | O=C/C=C/C=C\C(=O)O |
| InChI | InChI=1S/C6H6O3/c7-5-3-1-2-4-6(8)9/h1-5H,(H,8,9)/b3-1+,4-2- |
| InChIKey | MGCBXZGOSMSZBJ-TZFCGSKZSA-N |
| XLogP | 0.38 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 126.11 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|