C17H22N2O6 — CID 91534364
(3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate (PubChem CID 91534364) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate.
| Compound Name | (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate |
|---|---|
| PubChem CID | 91534364 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate |
| SMILES | CC(=O)OC(C)C(OC(C)=O)C(C/N=N/c1ccccc1)OC(C)=O |
| InChI | InChI=1S/C17H22N2O6/c1-11(23-12(2)20)17(25-14(4)22)16(24-13(3)21)10-18-19-15-8-6-5-7-9-15/h5-9,11,16-17H,10H2,1-4H3/b19-18+ |
| InChIKey | ILOFYWZAXSXKPQ-VHEBQXMUSA-N |
| XLogP | 2.59 |
| TPSA | 103.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|