(3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate

C17H22N2O6 — CID 91534364

IUPAC(3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate
SMILESCC(=O)OC(C)C(OC(C)=O)C(C/N=N/c1ccccc1)OC(C)=O
InChIInChI=1S/C17H22N2O6/c1-11(23-12(2)20)17(25-14(4)22)16(24-13(3)21)10-18-19-15-8-6-5-7-9-15/h5-9,11,16-17H,10H2,1-4H3/b19-18+
InChIKeyILOFYWZAXSXKPQ-VHEBQXMUSA-N
MW350.37 g/mol
LogP2.59
Rot. Bonds8

About (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate

(3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate (PubChem CID 91534364) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate.

Molecular Properties

Compound Name(3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate
PubChem CID91534364
Molecular FormulaC17H22N2O6
Molecular Weight350.37 g/mol
Exact Mass350.15
IUPAC Name(3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate
SMILESCC(=O)OC(C)C(OC(C)=O)C(C/N=N/c1ccccc1)OC(C)=O
InChIInChI=1S/C17H22N2O6/c1-11(23-12(2)20)17(25-14(4)22)16(24-13(3)21)10-18-19-15-8-6-5-7-9-15/h5-9,11,16-17H,10H2,1-4H3/b19-18+
InChIKeyILOFYWZAXSXKPQ-VHEBQXMUSA-N
XLogP2.59
TPSA103.62 Ų
H-Bond Donors
H-Bond Acceptors8
Rotatable Bonds8
Heavy Atoms25
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500350.37
LogP ≤ 52.59
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 108

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}

Analyze (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate?
The IUPAC name of (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate (CID 91534364) is (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate.
What is the SMILES notation for (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate?
The canonical SMILES for (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate is CC(=O)OC(C)C(OC(C)=O)C(C/N=N/c1ccccc1)OC(C)=O.
What is the InChIKey of (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate?
The InChIKey is ILOFYWZAXSXKPQ-VHEBQXMUSA-N. The full InChI is InChI=1S/C17H22N2O6/c1-11(23-12(2)20)17(25-14(4)22)16(24-13(3)21)10-18-19-15-8-6-5-7-9-15/h5-9,11,16-17H,10H2,1-4H3/b19-18+.
What are the key properties of (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate?
(3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate has a molecular weight of 350.37 g/mol, XLogP of 2.59, 8 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (3,4-diacetyloxy-5-phenyldiazenylpentan-2-yl) acetate is sourced from PubChem (CID 91534364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).