C21H24N4O9 — CID 135485009
[(5E)-2,3,4-triacetyloxy-5-[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]pentyl] acetate (PubChem CID 135485009) has the molecular formula C21H24N4O9 and a molecular weight of 476.44 g/mol. Its IUPAC name is [(5E)-2,3,4-triacetyloxy-5-[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]pentyl] acetate.
| Compound Name | [(5E)-2,3,4-triacetyloxy-5-[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]pentyl] acetate |
|---|---|
| PubChem CID | 135485009 |
| Molecular Formula | C21H24N4O9 |
| Molecular Weight | 476.44 g/mol |
| Exact Mass | 476.15 |
| IUPAC Name | [(5E)-2,3,4-triacetyloxy-5-[(4-oxo-3H-quinazolin-2-yl)hydrazinylidene]pentyl] acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(/C=N/Nc1nc2ccccc2c(=O)[nH]1)OC(C)=O |
| InChI | InChI=1S/C21H24N4O9/c1-11(26)31-10-18(33-13(3)28)19(34-14(4)29)17(32-12(2)27)9-22-25-21-23-16-8-6-5-7-15(16)20(30)24-21/h5-9,17-19H,10H2,1-4H3,(H2,23,24,25,30)/b22-9+ |
| InChIKey | FENOOCYBEBBYIR-LSFURLLWSA-N |
| XLogP | 0.68 |
| TPSA | 175.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.44 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|