C26H29N7O11 — CID 71733238
[(2R,3R,4S,5E)-2,3,4-triacetyloxy-5-[[2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]acetyl]hydrazinylidene]pentyl] acetate (PubChem CID 71733238) has the molecular formula C26H29N7O11 and a molecular weight of 615.56 g/mol. Its IUPAC name is [(2R,3R,4S,5E)-2,3,4-triacetyloxy-5-[[2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]acetyl]hydrazinylidene]pentyl] acetate.
| Compound Name | [(2R,3R,4S,5E)-2,3,4-triacetyloxy-5-[[2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]acetyl]hydrazinylidene]pentyl] acetate |
|---|---|
| PubChem CID | 71733238 |
| Molecular Formula | C26H29N7O11 |
| Molecular Weight | 615.56 g/mol |
| Exact Mass | 615.19 |
| IUPAC Name | [(2R,3R,4S,5E)-2,3,4-triacetyloxy-5-[[2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]acetyl]hydrazinylidene]pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](/C=N/NC(=O)Cn1nnc(CCN2C(=O)c3ccccc3C2=O)n1)OC(C)=O |
| InChI | InChI=1S/C26H29N7O11/c1-14(34)41-13-21(43-16(3)36)24(44-17(4)37)20(42-15(2)35)11-27-29-23(38)12-33-30-22(28-31-33)9-10-32-25(39)18-7-5-6-8-19(18)26(32)40/h5-8,11,20-21,24H,9-10,12-13H2,1-4H3,(H,29,38)/b27-11+/t20-,21+,24+/m0/s1 |
| InChIKey | CEUNBOIYHAHPNB-BSDCWGFKSA-N |
| XLogP | -1.03 |
| TPSA | 227.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 615.56 |
| LogP ≤ 5 | -1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|