C18H22N6O3 — CID 8650800
N-butyl-2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-methylacetamide (PubChem CID 8650800) has the molecular formula C18H22N6O3 and a molecular weight of 370.41 g/mol. Its IUPAC name is N-butyl-2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-methylacetamide.
| Compound Name | N-butyl-2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-methylacetamide |
|---|---|
| PubChem CID | 8650800 |
| Molecular Formula | C18H22N6O3 |
| Molecular Weight | 370.41 g/mol |
| Exact Mass | 370.18 |
| IUPAC Name | N-butyl-2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-methylacetamide |
| SMILES | CCCCN(C)C(=O)Cn1nnc(CCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C18H22N6O3/c1-3-4-10-22(2)16(25)12-24-20-15(19-21-24)9-11-23-17(26)13-7-5-6-8-14(13)18(23)27/h5-8H,3-4,9-12H2,1-2H3 |
| InChIKey | MPFQLTUTSZAJHG-UHFFFAOYSA-N |
| XLogP | 0.77 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.41 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|