C20H15N7O3 — CID 8994465
2-[2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 8994465) has the molecular formula C20H15N7O3 and a molecular weight of 401.39 g/mol. Its IUPAC name is 2-[2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8994465 |
| Molecular Formula | C20H15N7O3 |
| Molecular Weight | 401.39 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | 2-[2-[2-[(5-phenyl-1,3,4-oxadiazol-2-yl)methyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1nnn(Cc2nnc(-c3ccccc3)o2)n1 |
| InChI | InChI=1S/C20H15N7O3/c28-19-14-8-4-5-9-15(14)20(29)26(19)11-10-16-21-25-27(24-16)12-17-22-23-18(30-17)13-6-2-1-3-7-13/h1-9H,10-12H2 |
| InChIKey | IHYNDIFDVDJEJW-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 119.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.39 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|