C20H18N6O4 — CID 9055787
2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(4-methoxyphenyl)acetamide (PubChem CID 9055787) has the molecular formula C20H18N6O4 and a molecular weight of 406.40 g/mol. Its IUPAC name is 2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(4-methoxyphenyl)acetamide.
| Compound Name | 2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(4-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 9055787 |
| Molecular Formula | C20H18N6O4 |
| Molecular Weight | 406.40 g/mol |
| Exact Mass | 406.14 |
| IUPAC Name | 2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(4-methoxyphenyl)acetamide |
| SMILES | COc1ccc(NC(=O)Cn2nnc(CCN3C(=O)c4ccccc4C3=O)n2)cc1 |
| InChI | InChI=1S/C20H18N6O4/c1-30-14-8-6-13(7-9-14)21-18(27)12-26-23-17(22-24-26)10-11-25-19(28)15-4-2-3-5-16(15)20(25)29/h2-9H,10-12H2,1H3,(H,21,27) |
| InChIKey | YJRBROJLUJSCMR-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 119.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.40 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|