C20H17FN6O3 — CID 9055796
2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(2-fluoro-4-methylphenyl)acetamide (PubChem CID 9055796) has the molecular formula C20H17FN6O3 and a molecular weight of 408.39 g/mol. Its IUPAC name is 2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(2-fluoro-4-methylphenyl)acetamide.
| Compound Name | 2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(2-fluoro-4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 9055796 |
| Molecular Formula | C20H17FN6O3 |
| Molecular Weight | 408.39 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | 2-[5-[2-(1,3-dioxoisoindol-2-yl)ethyl]tetrazol-2-yl]-N-(2-fluoro-4-methylphenyl)acetamide |
| SMILES | Cc1ccc(NC(=O)Cn2nnc(CCN3C(=O)c4ccccc4C3=O)n2)c(F)c1 |
| InChI | InChI=1S/C20H17FN6O3/c1-12-6-7-16(15(21)10-12)22-18(28)11-27-24-17(23-25-27)8-9-26-19(29)13-4-2-3-5-14(13)20(26)30/h2-7,10H,8-9,11H2,1H3,(H,22,28) |
| InChIKey | HAPRMUZSNOIBDC-UHFFFAOYSA-N |
| XLogP | 1.60 |
| TPSA | 110.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.39 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|