C20H24N6O3 — CID 8520049
2-[2-[2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 8520049) has the molecular formula C20H24N6O3 and a molecular weight of 396.45 g/mol. Its IUPAC name is 2-[2-[2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8520049 |
| Molecular Formula | C20H24N6O3 |
| Molecular Weight | 396.45 g/mol |
| Exact Mass | 396.19 |
| IUPAC Name | 2-[2-[2-[2-[(2S,6S)-2,6-dimethylpiperidin-1-yl]-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | C[C@H]1CCC[C@H](C)N1C(=O)Cn1nnc(CCN2C(=O)c3ccccc3C2=O)n1 |
| InChI | InChI=1S/C20H24N6O3/c1-13-6-5-7-14(2)26(13)18(27)12-25-22-17(21-23-25)10-11-24-19(28)15-8-3-4-9-16(15)20(24)29/h3-4,8-9,13-14H,5-7,10-12H2,1-2H3/t13-,14-/m0/s1 |
| InChIKey | JNSJZXURDMLHNB-KBPBESRZSA-N |
| XLogP | 1.30 |
| TPSA | 101.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.45 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|