C23H25N5O3 — CID 8520075
2-[2-[2-[2-(1-adamantyl)-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 8520075) has the molecular formula C23H25N5O3 and a molecular weight of 419.49 g/mol. Its IUPAC name is 2-[2-[2-[2-(1-adamantyl)-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[2-(1-adamantyl)-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8520075 |
| Molecular Formula | C23H25N5O3 |
| Molecular Weight | 419.49 g/mol |
| Exact Mass | 419.20 |
| IUPAC Name | 2-[2-[2-[2-(1-adamantyl)-2-oxoethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | O=C1c2ccccc2C(=O)N1CCc1nnn(CC(=O)C23CC4CC(CC(C4)C2)C3)n1 |
| InChI | InChI=1S/C23H25N5O3/c29-19(23-10-14-7-15(11-23)9-16(8-14)12-23)13-28-25-20(24-26-28)5-6-27-21(30)17-3-1-2-4-18(17)22(27)31/h1-4,14-16H,5-13H2 |
| InChIKey | UFYRSMDPPAYHPO-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.49 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|