C23H23N5O3 — CID 8520261
2-[2-[2-[2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione (PubChem CID 8520261) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 2-[2-[2-[2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[2-[2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 8520261 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 2-[2-[2-[2-oxo-2-(2,3,4,5-tetramethylphenyl)ethyl]tetrazol-5-yl]ethyl]isoindole-1,3-dione |
| SMILES | Cc1cc(C(=O)Cn2nnc(CCN3C(=O)c4ccccc4C3=O)n2)c(C)c(C)c1C |
| InChI | InChI=1S/C23H23N5O3/c1-13-11-19(16(4)15(3)14(13)2)20(29)12-28-25-21(24-26-28)9-10-27-22(30)17-7-5-6-8-18(17)23(27)31/h5-8,11H,9-10,12H2,1-4H3 |
| InChIKey | QIKYJHRXCKRTOI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 98.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|