C20H20N6O2 — CID 3184427
2-[[5-(4-butoxyphenyl)tetrazol-2-yl]methyl]-5-phenyl-1,3,4-oxadiazole (PubChem CID 3184427) has the molecular formula C20H20N6O2 and a molecular weight of 376.42 g/mol. Its IUPAC name is 2-[[5-(4-butoxyphenyl)tetrazol-2-yl]methyl]-5-phenyl-1,3,4-oxadiazole.
| Compound Name | 2-[[5-(4-butoxyphenyl)tetrazol-2-yl]methyl]-5-phenyl-1,3,4-oxadiazole |
|---|---|
| PubChem CID | 3184427 |
| Molecular Formula | C20H20N6O2 |
| Molecular Weight | 376.42 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | 2-[[5-(4-butoxyphenyl)tetrazol-2-yl]methyl]-5-phenyl-1,3,4-oxadiazole |
| SMILES | CCCCOc1ccc(-c2nnn(Cc3nnc(-c4ccccc4)o3)n2)cc1 |
| InChI | InChI=1S/C20H20N6O2/c1-2-3-13-27-17-11-9-15(10-12-17)19-22-25-26(24-19)14-18-21-23-20(28-18)16-7-5-4-6-8-16/h4-12H,2-3,13-14H2,1H3 |
| InChIKey | ATGSYQJCCJJURI-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 91.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.42 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|