C31H31NO13 — CID 102383058
[(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(2-methyl-3,5,8-trioxo-4-phenylisoquinolin-1-yl)pentyl] acetate (PubChem CID 102383058) has the molecular formula C31H31NO13 and a molecular weight of 625.58 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(2-methyl-3,5,8-trioxo-4-phenylisoquinolin-1-yl)pentyl] acetate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(2-methyl-3,5,8-trioxo-4-phenylisoquinolin-1-yl)pentyl] acetate |
|---|---|
| PubChem CID | 102383058 |
| Molecular Formula | C31H31NO13 |
| Molecular Weight | 625.58 g/mol |
| Exact Mass | 625.18 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(2-methyl-3,5,8-trioxo-4-phenylisoquinolin-1-yl)pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)c1c2c(c(-c3ccccc3)c(=O)n1C)C(=O)C=CC2=O |
| InChI | InChI=1S/C31H31NO13/c1-15(33)41-14-23(42-16(2)34)28(43-17(3)35)30(45-19(5)37)29(44-18(4)36)27-26-22(39)13-12-21(38)25(26)24(31(40)32(27)6)20-10-8-7-9-11-20/h7-13,23,28-30H,14H2,1-6H3/t23-,28-,29-,30-/m1/s1 |
| InChIKey | BKCFUWWSTPOPHV-KVKKZVFNSA-N |
| XLogP | 1.95 |
| TPSA | 187.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 625.58 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|