C21H23BrN2O8S — CID 100935624
[(2R,3S,4R)-2,3,4-triacetyloxy-4-[3-(2-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]butyl] acetate (PubChem CID 100935624) has the molecular formula C21H23BrN2O8S and a molecular weight of 543.39 g/mol. Its IUPAC name is [(2R,3S,4R)-2,3,4-triacetyloxy-4-[3-(2-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]butyl] acetate.
| Compound Name | [(2R,3S,4R)-2,3,4-triacetyloxy-4-[3-(2-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]butyl] acetate |
|---|---|
| PubChem CID | 100935624 |
| Molecular Formula | C21H23BrN2O8S |
| Molecular Weight | 543.39 g/mol |
| Exact Mass | 542.04 |
| IUPAC Name | [(2R,3S,4R)-2,3,4-triacetyloxy-4-[3-(2-bromophenyl)-2-sulfanylidene-1H-imidazol-5-yl]butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)c1cn(-c2ccccc2Br)c(=S)[nH]1 |
| InChI | InChI=1S/C21H23BrN2O8S/c1-11(25)29-10-18(30-12(2)26)20(32-14(4)28)19(31-13(3)27)16-9-24(21(33)23-16)17-8-6-5-7-15(17)22/h5-9,18-20H,10H2,1-4H3,(H,23,33)/t18-,19-,20-/m1/s1 |
| InChIKey | FPEXWTGTWWCTOX-VAMGGRTRSA-N |
| XLogP | 3.33 |
| TPSA | 125.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.39 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|