C19H24N2O11 — CID 27059695
[(2R,3R,4S)-2,3,4-triacetyloxy-4-(1,3-diacetyl-2-oxoimidazol-4-yl)butyl] acetate (PubChem CID 27059695) has the molecular formula C19H24N2O11 and a molecular weight of 456.40 g/mol. Its IUPAC name is [(2R,3R,4S)-2,3,4-triacetyloxy-4-(1,3-diacetyl-2-oxoimidazol-4-yl)butyl] acetate.
| Compound Name | [(2R,3R,4S)-2,3,4-triacetyloxy-4-(1,3-diacetyl-2-oxoimidazol-4-yl)butyl] acetate |
|---|---|
| PubChem CID | 27059695 |
| Molecular Formula | C19H24N2O11 |
| Molecular Weight | 456.40 g/mol |
| Exact Mass | 456.14 |
| IUPAC Name | [(2R,3R,4S)-2,3,4-triacetyloxy-4-(1,3-diacetyl-2-oxoimidazol-4-yl)butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)c1cn(C(C)=O)c(=O)n1C(C)=O |
| InChI | InChI=1S/C19H24N2O11/c1-9(22)20-7-15(21(10(2)23)19(20)28)17(31-13(5)26)18(32-14(6)27)16(30-12(4)25)8-29-11(3)24/h7,16-18H,8H2,1-6H3/t16-,17+,18+/m1/s1 |
| InChIKey | QONCAQKKNWECFZ-SQNIBIBYSA-N |
| XLogP | 0.00 |
| TPSA | 166.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.40 |
| LogP ≤ 5 | 0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|