C28H36N2O16 — CID 91445924
4,5,6-triacetyloxy-3-[5-(1,2,3,4-tetraacetyloxybutyl)pyrazin-2-yl]hexanoic acid (PubChem CID 91445924) has the molecular formula C28H36N2O16 and a molecular weight of 656.59 g/mol. Its IUPAC name is 4,5,6-triacetyloxy-3-[5-(1,2,3,4-tetraacetyloxybutyl)pyrazin-2-yl]hexanoic acid.
| Compound Name | 4,5,6-triacetyloxy-3-[5-(1,2,3,4-tetraacetyloxybutyl)pyrazin-2-yl]hexanoic acid |
|---|---|
| PubChem CID | 91445924 |
| Molecular Formula | C28H36N2O16 |
| Molecular Weight | 656.59 g/mol |
| Exact Mass | 656.21 |
| IUPAC Name | 4,5,6-triacetyloxy-3-[5-(1,2,3,4-tetraacetyloxybutyl)pyrazin-2-yl]hexanoic acid |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)C(CC(=O)O)c1cnc(C(OC(C)=O)C(OC(C)=O)C(COC(C)=O)OC(C)=O)cn1 |
| InChI | InChI=1S/C28H36N2O16/c1-13(31)40-11-23(42-15(3)33)26(44-17(5)35)20(8-25(38)39)21-9-30-22(10-29-21)27(45-18(6)36)28(46-19(7)37)24(43-16(4)34)12-41-14(2)32/h9-10,20,23-24,26-28H,8,11-12H2,1-7H3,(H,38,39) |
| InChIKey | IHBFWPCWLSUWLN-UHFFFAOYSA-N |
| XLogP | 0.49 |
| TPSA | 247.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 17 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 656.59 |
| LogP ≤ 5 | 0.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 17 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|