C17H23N3O10 — CID 11407737
[(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(1H-1,2,4-triazol-5-yl)pentyl] acetate (PubChem CID 11407737) has the molecular formula C17H23N3O10 and a molecular weight of 429.38 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(1H-1,2,4-triazol-5-yl)pentyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(1H-1,2,4-triazol-5-yl)pentyl] acetate |
|---|---|
| PubChem CID | 11407737 |
| Molecular Formula | C17H23N3O10 |
| Molecular Weight | 429.38 g/mol |
| Exact Mass | 429.14 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(1H-1,2,4-triazol-5-yl)pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)c1ncn[nH]1 |
| InChI | InChI=1S/C17H23N3O10/c1-8(21)26-6-13(27-9(2)22)14(28-10(3)23)15(29-11(4)24)16(30-12(5)25)17-18-7-19-20-17/h7,13-16H,6H2,1-5H3,(H,18,19,20)/t13-,14-,15+,16-/m1/s1 |
| InChIKey | AIMNDDLFLDQNNO-LVQVYYBASA-N |
| XLogP | -0.23 |
| TPSA | 173.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.38 |
| LogP ≤ 5 | -0.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|