C20H29N3O10 — CID 16750841
[(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)pentyl] acetate (PubChem CID 16750841) has the molecular formula C20H29N3O10 and a molecular weight of 471.46 g/mol. Its IUPAC name is [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)pentyl] acetate.
| Compound Name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)pentyl] acetate |
|---|---|
| PubChem CID | 16750841 |
| Molecular Formula | C20H29N3O10 |
| Molecular Weight | 471.46 g/mol |
| Exact Mass | 471.19 |
| IUPAC Name | [(2R,3R,4S,5R)-2,3,4,5-tetraacetyloxy-5-(1-ethyl-5-methyl-1,2,4-triazol-3-yl)pentyl] acetate |
| SMILES | CCn1nc([C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)nc1C |
| InChI | InChI=1S/C20H29N3O10/c1-8-23-10(2)21-20(22-23)19(33-15(7)28)18(32-14(6)27)17(31-13(5)26)16(30-12(4)25)9-29-11(3)24/h16-19H,8-9H2,1-7H3/t16-,17-,18-,19+/m1/s1 |
| InChIKey | KXKCSMLPPLAQQF-MKXGPGLRSA-N |
| XLogP | 0.57 |
| TPSA | 162.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 471.46 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|