C18H24N2O10S2 — CID 10696464
[(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentyl] acetate (PubChem CID 10696464) has the molecular formula C18H24N2O10S2 and a molecular weight of 492.53 g/mol. Its IUPAC name is [(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentyl] acetate.
| Compound Name | [(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentyl] acetate |
|---|---|
| PubChem CID | 10696464 |
| Molecular Formula | C18H24N2O10S2 |
| Molecular Weight | 492.53 g/mol |
| Exact Mass | 492.09 |
| IUPAC Name | [(2R,3R,4S,5S)-2,3,4,5-tetraacetyloxy-5-(5-methylsulfanyl-1,3,4-thiadiazol-2-yl)pentyl] acetate |
| SMILES | CSc1nnc([C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)s1 |
| InChI | InChI=1S/C18H24N2O10S2/c1-8(21)26-7-13(27-9(2)22)14(28-10(3)23)15(29-11(4)24)16(30-12(5)25)17-19-20-18(31-6)32-17/h13-16H,7H2,1-6H3/t13-,14-,15+,16+/m1/s1 |
| InChIKey | YIOSWLNLSOOAEO-WCVJEAGWSA-N |
| XLogP | 1.22 |
| TPSA | 157.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 14 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 492.53 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 14 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|