C22H25N3O9S — CID 10973230
[(2R,3R,4S)-4-[5-(N-acetylanilino)-1,3,4-thiadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate (PubChem CID 10973230) has the molecular formula C22H25N3O9S and a molecular weight of 507.52 g/mol. Its IUPAC name is [(2R,3R,4S)-4-[5-(N-acetylanilino)-1,3,4-thiadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate.
| Compound Name | [(2R,3R,4S)-4-[5-(N-acetylanilino)-1,3,4-thiadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate |
|---|---|
| PubChem CID | 10973230 |
| Molecular Formula | C22H25N3O9S |
| Molecular Weight | 507.52 g/mol |
| Exact Mass | 507.13 |
| IUPAC Name | [(2R,3R,4S)-4-[5-(N-acetylanilino)-1,3,4-thiadiazol-2-yl]-2,3,4-triacetyloxybutyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)c1nnc(N(C(C)=O)c2ccccc2)s1 |
| InChI | InChI=1S/C22H25N3O9S/c1-12(26)25(17-9-7-6-8-10-17)22-24-23-21(35-22)20(34-16(5)30)19(33-15(4)29)18(32-14(3)28)11-31-13(2)27/h6-10,18-20H,11H2,1-5H3/t18-,19-,20+/m1/s1 |
| InChIKey | ZDQUQIMTXIQPMF-AQNXPRMDSA-N |
| XLogP | 2.25 |
| TPSA | 151.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.52 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|