C20H23N3O8 — CID 7784701
[(2R,3R,4R)-2,3,4-triacetyloxy-4-(2-phenyltriazol-4-yl)butyl] acetate (PubChem CID 7784701) has the molecular formula C20H23N3O8 and a molecular weight of 433.42 g/mol. Its IUPAC name is [(2R,3R,4R)-2,3,4-triacetyloxy-4-(2-phenyltriazol-4-yl)butyl] acetate.
| Compound Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-(2-phenyltriazol-4-yl)butyl] acetate |
|---|---|
| PubChem CID | 7784701 |
| Molecular Formula | C20H23N3O8 |
| Molecular Weight | 433.42 g/mol |
| Exact Mass | 433.15 |
| IUPAC Name | [(2R,3R,4R)-2,3,4-triacetyloxy-4-(2-phenyltriazol-4-yl)butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)c1cnn(-c2ccccc2)n1 |
| InChI | InChI=1S/C20H23N3O8/c1-12(24)28-11-18(29-13(2)25)20(31-15(4)27)19(30-14(3)26)17-10-21-23(22-17)16-8-6-5-7-9-16/h5-10,18-20H,11H2,1-4H3/t18-,19-,20+/m1/s1 |
| InChIKey | FAVCUUQOZGVLMI-AQNXPRMDSA-N |
| XLogP | 1.30 |
| TPSA | 135.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.42 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|