C31H31N5O10 — CID 10579900
[(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)pentyl] acetate (PubChem CID 10579900) has the molecular formula C31H31N5O10 and a molecular weight of 633.61 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)pentyl] acetate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)pentyl] acetate |
|---|---|
| PubChem CID | 10579900 |
| Molecular Formula | C31H31N5O10 |
| Molecular Weight | 633.61 g/mol |
| Exact Mass | 633.21 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5-tetraacetyloxy-5-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)c1nnc2nc(-c3ccccc3)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C31H31N5O10/c1-17(37)42-16-24(43-18(2)38)27(44-19(3)39)28(45-20(4)40)29(46-21(5)41)30-33-34-31-32-25(22-12-8-6-9-13-22)26(35-36(30)31)23-14-10-7-11-15-23/h6-15,24,27-29H,16H2,1-5H3/t24-,27-,28+,29+/m1/s1 |
| InChIKey | PEFKYSVKXFYTGS-MBOHLOIDSA-N |
| XLogP | 2.82 |
| TPSA | 187.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 633.61 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|