C28H30N2O11 — CID 101188159
[(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(4-cyano-1-methyl-6-oxo-5-phenyl-2-pyridinyl)pentyl] acetate (PubChem CID 101188159) has the molecular formula C28H30N2O11 and a molecular weight of 570.55 g/mol. Its IUPAC name is [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(4-cyano-1-methyl-6-oxo-5-phenyl-2-pyridinyl)pentyl] acetate.
| Compound Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(4-cyano-1-methyl-6-oxo-5-phenyl-2-pyridinyl)pentyl] acetate |
|---|---|
| PubChem CID | 101188159 |
| Molecular Formula | C28H30N2O11 |
| Molecular Weight | 570.55 g/mol |
| Exact Mass | 570.18 |
| IUPAC Name | [(2R,3R,4R,5S)-2,3,4,5-tetraacetyloxy-5-(4-cyano-1-methyl-6-oxo-5-phenyl-2-pyridinyl)pentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)c1cc(C#N)c(-c2ccccc2)c(=O)n1C |
| InChI | InChI=1S/C28H30N2O11/c1-15(31)37-14-23(38-16(2)32)26(40-18(4)34)27(41-19(5)35)25(39-17(3)33)22-12-21(13-29)24(28(36)30(22)6)20-10-8-7-9-11-20/h7-12,23,25-27H,14H2,1-6H3/t23-,25+,26-,27-/m1/s1 |
| InChIKey | ULZOZZDWZCUMLK-INVSNAKLSA-N |
| XLogP | 1.89 |
| TPSA | 177.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.55 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|