C28H27N5O8 — CID 10602969
[(2R,3S,4S)-2,3,4-triacetyloxy-4-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)butyl] acetate (PubChem CID 10602969) has the molecular formula C28H27N5O8 and a molecular weight of 561.55 g/mol. Its IUPAC name is [(2R,3S,4S)-2,3,4-triacetyloxy-4-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)butyl] acetate.
| Compound Name | [(2R,3S,4S)-2,3,4-triacetyloxy-4-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)butyl] acetate |
|---|---|
| PubChem CID | 10602969 |
| Molecular Formula | C28H27N5O8 |
| Molecular Weight | 561.55 g/mol |
| Exact Mass | 561.19 |
| IUPAC Name | [(2R,3S,4S)-2,3,4-triacetyloxy-4-(6,7-diphenyl-[1,2,4]triazolo[4,3-b][1,2,4]triazin-3-yl)butyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)c1nnc2nc(-c3ccccc3)c(-c3ccccc3)nn12 |
| InChI | InChI=1S/C28H27N5O8/c1-16(34)38-15-22(39-17(2)35)25(40-18(3)36)26(41-19(4)37)27-30-31-28-29-23(20-11-7-5-8-12-20)24(32-33(27)28)21-13-9-6-10-14-21/h5-14,22,25-26H,15H2,1-4H3/t22-,25-,26-/m1/s1 |
| InChIKey | ULSJFTXNPYVRGI-DNRSQYFGSA-N |
| XLogP | 2.88 |
| TPSA | 161.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|