C14H17NO6 — CID 134835456
(2,3-diacetyloxy-3-pyridin-2-ylpropyl) acetate (PubChem CID 134835456) has the molecular formula C14H17NO6 and a molecular weight of 295.29 g/mol. Its IUPAC name is (2,3-diacetyloxy-3-pyridin-2-ylpropyl) acetate.
| Compound Name | (2,3-diacetyloxy-3-pyridin-2-ylpropyl) acetate |
|---|---|
| PubChem CID | 134835456 |
| Molecular Formula | C14H17NO6 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | (2,3-diacetyloxy-3-pyridin-2-ylpropyl) acetate |
| SMILES | CC(=O)OCC(OC(C)=O)C(OC(C)=O)c1ccccn1 |
| InChI | InChI=1S/C14H17NO6/c1-9(16)19-8-13(20-10(2)17)14(21-11(3)18)12-6-4-5-7-15-12/h4-7,13-14H,8H2,1-3H3 |
| InChIKey | QQQWHNDPMNISHW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 91.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|