About [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate
[(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate (PubChem CID 10645120) has the molecular formula C17H20N4O8
and a molecular weight of 408.37 g/mol. Its IUPAC name is [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate.
Molecular Properties
| Compound Name | [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate |
| PubChem CID | 10645120 |
| Molecular Formula | C17H20N4O8 |
| Molecular Weight | 408.37 g/mol |
| Exact Mass | 408.13 |
| IUPAC Name | [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate |
| SMILES | COc1nc2nc([C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)cnc2c(=O)n1C |
| InChI | InChI=1S/C17H20N4O8/c1-8(22)27-7-12(28-9(2)23)14(29-10(3)24)11-6-18-13-15(19-11)20-17(26-5)21(4)16(13)25/h6,12,14H,7H2,1-5H3/t12-,14-/m1/s1 |
| InChIKey | MRKOTWXHGUZPDK-TZMCWYRMSA-N |
| XLogP | -0.17 |
| TPSA | 148.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 408.37 |
| LogP ≤ 5 | -0.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|
Analyze [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate?
The IUPAC name of [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate (CID 10645120) is [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate.
What is the SMILES notation for [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate?
The canonical SMILES for [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate is COc1nc2nc([C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)cnc2c(=O)n1C.
What is the InChIKey of [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate?
The InChIKey is MRKOTWXHGUZPDK-TZMCWYRMSA-N. The full InChI is InChI=1S/C17H20N4O8/c1-8(22)27-7-12(28-9(2)23)14(29-10(3)24)11-6-18-13-15(19-11)20-17(26-5)21(4)16(13)25/h6,12,14H,7H2,1-5H3/t12-,14-/m1/s1.
What are the key properties of [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate?
[(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate has a molecular weight of 408.37 g/mol, XLogP of -0.17, 7 rotatable bonds, 0 hydrogen bond donors, and 12 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,3R)-2,3-diacetyloxy-3-(2-methoxy-3-methyl-4-oxopteridin-7-yl)propyl] acetate is sourced from PubChem (CID 10645120), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).