C18H21NO11 — CID 11189535
methyl 5-acetamido-4-oxo-6-[(1S,2S)-1,2,3-triacetyloxypropyl]pyran-2-carboxylate (PubChem CID 11189535) has the molecular formula C18H21NO11 and a molecular weight of 427.36 g/mol. Its IUPAC name is methyl 5-acetamido-4-oxo-6-[(1S,2S)-1,2,3-triacetyloxypropyl]pyran-2-carboxylate.
| Compound Name | methyl 5-acetamido-4-oxo-6-[(1S,2S)-1,2,3-triacetyloxypropyl]pyran-2-carboxylate |
|---|---|
| PubChem CID | 11189535 |
| Molecular Formula | C18H21NO11 |
| Molecular Weight | 427.36 g/mol |
| Exact Mass | 427.11 |
| IUPAC Name | methyl 5-acetamido-4-oxo-6-[(1S,2S)-1,2,3-triacetyloxypropyl]pyran-2-carboxylate |
| SMILES | COC(=O)c1cc(=O)c(NC(C)=O)c([C@@H](OC(C)=O)[C@H](COC(C)=O)OC(C)=O)o1 |
| InChI | InChI=1S/C18H21NO11/c1-8(20)19-15-12(24)6-13(18(25)26-5)30-17(15)16(29-11(4)23)14(28-10(3)22)7-27-9(2)21/h6,14,16H,7H2,1-5H3,(H,19,20)/t14-,16-/m0/s1 |
| InChIKey | CZMVZUHSHHPKGI-HOCLYGCPSA-N |
| XLogP | 0.48 |
| TPSA | 164.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.36 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|