C18H20Cl3NO10 — CID 100994508
methyl 5-[(1R,2S,3R)-2,3,4-triacetyloxy-1-[(2,2,2-trichloroacetyl)amino]butyl]furan-2-carboxylate (PubChem CID 100994508) has the molecular formula C18H20Cl3NO10 and a molecular weight of 516.71 g/mol. Its IUPAC name is methyl 5-[(1R,2S,3R)-2,3,4-triacetyloxy-1-[(2,2,2-trichloroacetyl)amino]butyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(1R,2S,3R)-2,3,4-triacetyloxy-1-[(2,2,2-trichloroacetyl)amino]butyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 100994508 |
| Molecular Formula | C18H20Cl3NO10 |
| Molecular Weight | 516.71 g/mol |
| Exact Mass | 515.02 |
| IUPAC Name | methyl 5-[(1R,2S,3R)-2,3,4-triacetyloxy-1-[(2,2,2-trichloroacetyl)amino]butyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc([C@H](NC(=O)C(Cl)(Cl)Cl)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)o1 |
| InChI | InChI=1S/C18H20Cl3NO10/c1-8(23)29-7-13(30-9(2)24)15(31-10(3)25)14(22-17(27)18(19,20)21)11-5-6-12(32-11)16(26)28-4/h5-6,13-15H,7H2,1-4H3,(H,22,27)/t13-,14+,15-/m1/s1 |
| InChIKey | BEUATOWIYXETJQ-QLFBSQMISA-N |
| XLogP | 2.02 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 516.71 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|