C21H28N2O9 — CID 98175699
[(2S,3S,4R)-2,3,4-triacetyloxy-5-[4-(dimethylamino)anilino]-5-oxopentyl] acetate (PubChem CID 98175699) has the molecular formula C21H28N2O9 and a molecular weight of 452.46 g/mol. Its IUPAC name is [(2S,3S,4R)-2,3,4-triacetyloxy-5-[4-(dimethylamino)anilino]-5-oxopentyl] acetate.
| Compound Name | [(2S,3S,4R)-2,3,4-triacetyloxy-5-[4-(dimethylamino)anilino]-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 98175699 |
| Molecular Formula | C21H28N2O9 |
| Molecular Weight | 452.46 g/mol |
| Exact Mass | 452.18 |
| IUPAC Name | [(2S,3S,4R)-2,3,4-triacetyloxy-5-[4-(dimethylamino)anilino]-5-oxopentyl] acetate |
| SMILES | CC(=O)OC[C@H](OC(C)=O)[C@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)Nc1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C21H28N2O9/c1-12(24)29-11-18(30-13(2)25)19(31-14(3)26)20(32-15(4)27)21(28)22-16-7-9-17(10-8-16)23(5)6/h7-10,18-20H,11H2,1-6H3,(H,22,28)/t18-,19-,20+/m0/s1 |
| InChIKey | KBVJXIUSKWAASH-SLFFLAALSA-N |
| XLogP | 1.05 |
| TPSA | 137.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 452.46 |
| LogP ≤ 5 | 1.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|