C22H24N2O6 — CID 4556529
[3-acetyloxy-1,4-bis(4-methylanilino)-1,4-dioxobutan-2-yl] acetate (PubChem CID 4556529) has the molecular formula C22H24N2O6 and a molecular weight of 412.44 g/mol. Its IUPAC name is [3-acetyloxy-1,4-bis(4-methylanilino)-1,4-dioxobutan-2-yl] acetate.
| Compound Name | [3-acetyloxy-1,4-bis(4-methylanilino)-1,4-dioxobutan-2-yl] acetate |
|---|---|
| PubChem CID | 4556529 |
| Molecular Formula | C22H24N2O6 |
| Molecular Weight | 412.44 g/mol |
| Exact Mass | 412.16 |
| IUPAC Name | [3-acetyloxy-1,4-bis(4-methylanilino)-1,4-dioxobutan-2-yl] acetate |
| SMILES | CC(=O)OC(C(=O)Nc1ccc(C)cc1)C(OC(C)=O)C(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H24N2O6/c1-13-5-9-17(10-6-13)23-21(27)19(29-15(3)25)20(30-16(4)26)22(28)24-18-11-7-14(2)8-12-18/h5-12,19-20H,1-4H3,(H,23,27)(H,24,28) |
| InChIKey | CIXGTQORDUQSKE-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 110.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.44 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |