C21H27NO9 — CID 40624558
[(2R,3R,4R)-2,3,4-triacetyloxy-5-(2,4-dimethylanilino)-5-oxopentyl] acetate (PubChem CID 40624558) has the molecular formula C21H27NO9 and a molecular weight of 437.45 g/mol. Its IUPAC name is [(2R,3R,4R)-2,3,4-triacetyloxy-5-(2,4-dimethylanilino)-5-oxopentyl] acetate.
| Compound Name | [(2R,3R,4R)-2,3,4-triacetyloxy-5-(2,4-dimethylanilino)-5-oxopentyl] acetate |
|---|---|
| PubChem CID | 40624558 |
| Molecular Formula | C21H27NO9 |
| Molecular Weight | 437.45 g/mol |
| Exact Mass | 437.17 |
| IUPAC Name | [(2R,3R,4R)-2,3,4-triacetyloxy-5-(2,4-dimethylanilino)-5-oxopentyl] acetate |
| SMILES | CC(=O)OC[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C21H27NO9/c1-11-7-8-17(12(2)9-11)22-21(27)20(31-16(6)26)19(30-15(5)25)18(29-14(4)24)10-28-13(3)23/h7-9,18-20H,10H2,1-6H3,(H,22,27)/t18-,19-,20-/m1/s1 |
| InChIKey | SNSYWTDXYZISJL-VAMGGRTRSA-N |
| XLogP | 1.60 |
| TPSA | 134.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.45 |
| LogP ≤ 5 | 1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|