C24H31NO11S — CID 98053690
ethyl 2-[[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 98053690) has the molecular formula C24H31NO11S and a molecular weight of 541.58 g/mol. Its IUPAC name is ethyl 2-[[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 98053690 |
| Molecular Formula | C24H31NO11S |
| Molecular Weight | 541.58 g/mol |
| Exact Mass | 541.16 |
| IUPAC Name | ethyl 2-[[(2S,3S,4R)-2,3,4,5-tetraacetyloxypentanoyl]amino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(NC(=O)[C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)sc2c1CCCC2 |
| InChI | InChI=1S/C24H31NO11S/c1-6-32-24(31)19-16-9-7-8-10-18(16)37-23(19)25-22(30)21(36-15(5)29)20(35-14(4)28)17(34-13(3)27)11-33-12(2)26/h17,20-21H,6-11H2,1-5H3,(H,25,30)/t17-,20+,21+/m1/s1 |
| InChIKey | VBXTZRIJUOTCTN-QMMLZNLJSA-N |
| XLogP | 2.10 |
| TPSA | 160.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 541.58 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|