C23H25NO10 — CID 100994506
methyl 5-[(1S,2S,3R)-2,3,4-triacetyloxy-1-benzamidobutyl]furan-2-carboxylate (PubChem CID 100994506) has the molecular formula C23H25NO10 and a molecular weight of 475.45 g/mol. Its IUPAC name is methyl 5-[(1S,2S,3R)-2,3,4-triacetyloxy-1-benzamidobutyl]furan-2-carboxylate.
| Compound Name | methyl 5-[(1S,2S,3R)-2,3,4-triacetyloxy-1-benzamidobutyl]furan-2-carboxylate |
|---|---|
| PubChem CID | 100994506 |
| Molecular Formula | C23H25NO10 |
| Molecular Weight | 475.45 g/mol |
| Exact Mass | 475.15 |
| IUPAC Name | methyl 5-[(1S,2S,3R)-2,3,4-triacetyloxy-1-benzamidobutyl]furan-2-carboxylate |
| SMILES | COC(=O)c1ccc([C@@H](NC(=O)c2ccccc2)[C@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)o1 |
| InChI | InChI=1S/C23H25NO10/c1-13(25)31-12-19(32-14(2)26)21(33-15(3)27)20(17-10-11-18(34-17)23(29)30-4)24-22(28)16-8-6-5-7-9-16/h5-11,19-21H,12H2,1-4H3,(H,24,28)/t19-,20-,21-/m1/s1 |
| InChIKey | SGEKKROINQXJAA-NJDAHSKKSA-N |
| XLogP | 1.96 |
| TPSA | 147.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 475.45 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|