C20H23N5O10 — CID 136830145
[(2R,3R,4R)-4-(2-acetamido-4-oxo-3H-pteridin-6-yl)-2,3,4-triacetyloxybutyl] acetate (PubChem CID 136830145) has the molecular formula C20H23N5O10 and a molecular weight of 493.43 g/mol. Its IUPAC name is [(2R,3R,4R)-4-(2-acetamido-4-oxo-3H-pteridin-6-yl)-2,3,4-triacetyloxybutyl] acetate.
| Compound Name | [(2R,3R,4R)-4-(2-acetamido-4-oxo-3H-pteridin-6-yl)-2,3,4-triacetyloxybutyl] acetate |
|---|---|
| PubChem CID | 136830145 |
| Molecular Formula | C20H23N5O10 |
| Molecular Weight | 493.43 g/mol |
| Exact Mass | 493.14 |
| IUPAC Name | [(2R,3R,4R)-4-(2-acetamido-4-oxo-3H-pteridin-6-yl)-2,3,4-triacetyloxybutyl] acetate |
| SMILES | CC(=O)Nc1nc2ncc([C@@H](OC(C)=O)[C@@H](OC(C)=O)[C@@H](COC(C)=O)OC(C)=O)nc2c(=O)[nH]1 |
| InChI | InChI=1S/C20H23N5O10/c1-8(26)22-20-24-18-15(19(31)25-20)23-13(6-21-18)16(34-11(4)29)17(35-12(5)30)14(33-10(3)28)7-32-9(2)27/h6,14,16-17H,7H2,1-5H3,(H2,21,22,24,25,26,31)/t14-,16-,17+/m1/s1 |
| InChIKey | CQDHYDMGOJNAEF-OIISXLGYSA-N |
| XLogP | -0.30 |
| TPSA | 205.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 493.43 |
| LogP ≤ 5 | -0.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|