C48H37N3O10 — CID 99678986
[(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-(2-phenyltriazol-4-yl)pentyl] benzoate (PubChem CID 99678986) has the molecular formula C48H37N3O10 and a molecular weight of 815.84 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-(2-phenyltriazol-4-yl)pentyl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-(2-phenyltriazol-4-yl)pentyl] benzoate |
|---|---|
| PubChem CID | 99678986 |
| Molecular Formula | C48H37N3O10 |
| Molecular Weight | 815.84 g/mol |
| Exact Mass | 815.25 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-(2-phenyltriazol-4-yl)pentyl] benzoate |
| SMILES | O=C(OC[C@@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)[C@H](OC(=O)c1ccccc1)c1cnn(-c2ccccc2)n1)c1ccccc1 |
| InChI | InChI=1S/C48H37N3O10/c52-44(33-19-7-1-8-20-33)57-32-40(58-45(53)34-21-9-2-10-22-34)42(60-47(55)36-25-13-4-14-26-36)43(61-48(56)37-27-15-5-16-28-37)41(59-46(54)35-23-11-3-12-24-35)39-31-49-51(50-39)38-29-17-6-18-30-38/h1-31,40-43H,32H2/t40-,41-,42-,43-/m1/s1 |
| InChIKey | LBPGVWUVZKBMGN-MRWFHJSOSA-N |
| XLogP | 7.70 |
| TPSA | 162.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 815.84 |
| LogP ≤ 5 | 7.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|