C47H43ClN3O10+ — CID 100996807
[(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-[2-(2-chloropropan-2-yl)-5,5-dimethyl-1,2,4-triazol-2-ium-3-yl]pentyl] benzoate (PubChem CID 100996807) has the molecular formula C47H43ClN3O10+ and a molecular weight of 845.33 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-[2-(2-chloropropan-2-yl)-5,5-dimethyl-1,2,4-triazol-2-ium-3-yl]pentyl] benzoate.
| Compound Name | [(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-[2-(2-chloropropan-2-yl)-5,5-dimethyl-1,2,4-triazol-2-ium-3-yl]pentyl] benzoate |
|---|---|
| PubChem CID | 100996807 |
| Molecular Formula | C47H43ClN3O10+ |
| Molecular Weight | 845.33 g/mol |
| Exact Mass | 844.26 |
| IUPAC Name | [(2R,3R,4R,5R)-2,3,4,5-tetrabenzoyloxy-5-[2-(2-chloropropan-2-yl)-5,5-dimethyl-1,2,4-triazol-2-ium-3-yl]pentyl] benzoate |
| SMILES | CC1(C)N=C([C@@H](OC(=O)c2ccccc2)C(OC(=O)c2ccccc2)[C@H](OC(=O)c2ccccc2)[C@@H](COC(=O)c2ccccc2)OC(=O)c2ccccc2)[N+](C(C)(C)Cl)=N1 |
| InChI | InChI=1S/C47H43ClN3O10/c1-46(2,48)51-40(49-47(3,4)50-51)39(61-45(56)35-28-18-9-19-29-35)38(60-44(55)34-26-16-8-17-27-34)37(59-43(54)33-24-14-7-15-25-33)36(58-42(53)32-22-12-6-13-23-32)30-57-41(52)31-20-10-5-11-21-31/h5-29,36-39H,30H2,1-4H3/q+1/t36-,37-,38?,39+/m1/s1 |
| InChIKey | UQQCYSXBCRUXHN-PEWRIVTNSA-N |
| XLogP | 8.33 |
| TPSA | 159.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 61 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 845.33 |
| LogP ≤ 5 | 8.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|