C29H30O7 — CID 11260363
[(2R,3R,4R)-3-hydroxy-4-methyl-2-(4-methylbenzoyl)oxy-5-oxo-4-phenylmethoxypentyl] 4-methylbenzoate (PubChem CID 11260363) has the molecular formula C29H30O7 and a molecular weight of 490.55 g/mol. Its IUPAC name is [(2R,3R,4R)-3-hydroxy-4-methyl-2-(4-methylbenzoyl)oxy-5-oxo-4-phenylmethoxypentyl] 4-methylbenzoate.
| Compound Name | [(2R,3R,4R)-3-hydroxy-4-methyl-2-(4-methylbenzoyl)oxy-5-oxo-4-phenylmethoxypentyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 11260363 |
| Molecular Formula | C29H30O7 |
| Molecular Weight | 490.55 g/mol |
| Exact Mass | 490.20 |
| IUPAC Name | [(2R,3R,4R)-3-hydroxy-4-methyl-2-(4-methylbenzoyl)oxy-5-oxo-4-phenylmethoxypentyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OC[C@@H](OC(=O)c2ccc(C)cc2)[C@@H](O)[C@](C)(C=O)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C29H30O7/c1-20-9-13-23(14-10-20)27(32)34-18-25(36-28(33)24-15-11-21(2)12-16-24)26(31)29(3,19-30)35-17-22-7-5-4-6-8-22/h4-16,19,25-26,31H,17-18H2,1-3H3/t25-,26-,29+/m1/s1 |
| InChIKey | KLXBVCRRRMVQEK-GEBXHLAXSA-N |
| XLogP | 4.22 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 490.55 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|