C21H20O7 — CID 58332179
[(1R,2R)-1,2-diformyloxy-4-(4-methylphenyl)-4-oxobutyl] 4-methylbenzoate (PubChem CID 58332179) has the molecular formula C21H20O7 and a molecular weight of 384.38 g/mol. Its IUPAC name is [(1R,2R)-1,2-diformyloxy-4-(4-methylphenyl)-4-oxobutyl] 4-methylbenzoate.
| Compound Name | [(1R,2R)-1,2-diformyloxy-4-(4-methylphenyl)-4-oxobutyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 58332179 |
| Molecular Formula | C21H20O7 |
| Molecular Weight | 384.38 g/mol |
| Exact Mass | 384.12 |
| IUPAC Name | [(1R,2R)-1,2-diformyloxy-4-(4-methylphenyl)-4-oxobutyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)C[C@@H](OC=O)[C@H](OC=O)OC(=O)c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C21H20O7/c1-14-3-7-16(8-4-14)18(24)11-19(26-12-22)21(27-13-23)28-20(25)17-9-5-15(2)6-10-17/h3-10,12-13,19,21H,11H2,1-2H3/t19-,21-/m1/s1 |
| InChIKey | JVWXWKJWEOXYSA-TZIWHRDSSA-N |
| XLogP | 2.77 |
| TPSA | 95.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.38 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|