C31H31NO6 — CID 71010716
[(3R,4S)-6-cyano-2-hydroxy-4-methyl-3-(4-methylbenzoyl)oxy-4-phenylmethoxyhex-5-enyl] 4-methylbenzoate (PubChem CID 71010716) has the molecular formula C31H31NO6 and a molecular weight of 513.59 g/mol. Its IUPAC name is [(3R,4S)-6-cyano-2-hydroxy-4-methyl-3-(4-methylbenzoyl)oxy-4-phenylmethoxyhex-5-enyl] 4-methylbenzoate.
| Compound Name | [(3R,4S)-6-cyano-2-hydroxy-4-methyl-3-(4-methylbenzoyl)oxy-4-phenylmethoxyhex-5-enyl] 4-methylbenzoate |
|---|---|
| PubChem CID | 71010716 |
| Molecular Formula | C31H31NO6 |
| Molecular Weight | 513.59 g/mol |
| Exact Mass | 513.22 |
| IUPAC Name | [(3R,4S)-6-cyano-2-hydroxy-4-methyl-3-(4-methylbenzoyl)oxy-4-phenylmethoxyhex-5-enyl] 4-methylbenzoate |
| SMILES | Cc1ccc(C(=O)OCC(O)[C@@H](OC(=O)c2ccc(C)cc2)[C@](C)(C=CC#N)OCc2ccccc2)cc1 |
| InChI | InChI=1S/C31H31NO6/c1-22-10-14-25(15-11-22)29(34)36-21-27(33)28(38-30(35)26-16-12-23(2)13-17-26)31(3,18-7-19-32)37-20-24-8-5-4-6-9-24/h4-18,27-28,33H,20-21H2,1-3H3/t27?,28-,31+/m1/s1 |
| InChIKey | AQNVXFSDCYJDQD-FZXMQELPSA-N |
| XLogP | 5.10 |
| TPSA | 105.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 513.59 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|