C40H36O7S2 — CID 10941494
[(2R,3R,4R)-3,4-dibenzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate (PubChem CID 10941494) has the molecular formula C40H36O7S2 and a molecular weight of 692.86 g/mol. Its IUPAC name is [(2R,3R,4R)-3,4-dibenzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate.
| Compound Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate |
|---|---|
| PubChem CID | 10941494 |
| Molecular Formula | C40H36O7S2 |
| Molecular Weight | 692.86 g/mol |
| Exact Mass | 692.19 |
| IUPAC Name | [(2R,3R,4R)-3,4-dibenzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate |
| SMILES | O=C(OC[C@@H](O)[C@@H](OC(=O)c1ccccc1)[C@@H](OC(=O)c1ccccc1)C(SCc1ccccc1)SCc1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C40H36O7S2/c41-34(26-45-37(42)31-20-10-3-11-21-31)35(46-38(43)32-22-12-4-13-23-32)36(47-39(44)33-24-14-5-15-25-33)40(48-27-29-16-6-1-7-17-29)49-28-30-18-8-2-9-19-30/h1-25,34-36,40-41H,26-28H2/t34-,35-,36-/m1/s1 |
| InChIKey | QHDZIAYSLGHIRI-KUFDTJSHSA-N |
| XLogP | 7.85 |
| TPSA | 99.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 692.86 |
| LogP ≤ 5 | 7.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|