C33H32O5S2 — CID 10721821
[(2S,3S)-3-benzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate (PubChem CID 10721821) has the molecular formula C33H32O5S2 and a molecular weight of 572.75 g/mol. Its IUPAC name is [(2S,3S)-3-benzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate.
| Compound Name | [(2S,3S)-3-benzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate |
|---|---|
| PubChem CID | 10721821 |
| Molecular Formula | C33H32O5S2 |
| Molecular Weight | 572.75 g/mol |
| Exact Mass | 572.17 |
| IUPAC Name | [(2S,3S)-3-benzoyloxy-5,5-bis(benzylsulfanyl)-2-hydroxypentyl] benzoate |
| SMILES | O=C(OC[C@H](O)[C@H](CC(SCc1ccccc1)SCc1ccccc1)OC(=O)c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C33H32O5S2/c34-29(22-37-32(35)27-17-9-3-10-18-27)30(38-33(36)28-19-11-4-12-20-28)21-31(39-23-25-13-5-1-6-14-25)40-24-26-15-7-2-8-16-26/h1-20,29-31,34H,21-24H2/t29-,30-/m0/s1 |
| InChIKey | GKVNAEXKWSEYTD-KYJUHHDHSA-N |
| XLogP | 7.01 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.75 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|