C26H28O4S2 — CID 10766694
[(3S,4S)-1,1-bis(benzylsulfanyl)-4,5-dihydroxypentan-3-yl] benzoate (PubChem CID 10766694) has the molecular formula C26H28O4S2 and a molecular weight of 468.64 g/mol. Its IUPAC name is [(3S,4S)-1,1-bis(benzylsulfanyl)-4,5-dihydroxypentan-3-yl] benzoate.
| Compound Name | [(3S,4S)-1,1-bis(benzylsulfanyl)-4,5-dihydroxypentan-3-yl] benzoate |
|---|---|
| PubChem CID | 10766694 |
| Molecular Formula | C26H28O4S2 |
| Molecular Weight | 468.64 g/mol |
| Exact Mass | 468.14 |
| IUPAC Name | [(3S,4S)-1,1-bis(benzylsulfanyl)-4,5-dihydroxypentan-3-yl] benzoate |
| SMILES | O=C(O[C@@H](CC(SCc1ccccc1)SCc1ccccc1)[C@@H](O)CO)c1ccccc1 |
| InChI | InChI=1S/C26H28O4S2/c27-17-23(28)24(30-26(29)22-14-8-3-9-15-22)16-25(31-18-20-10-4-1-5-11-20)32-19-21-12-6-2-7-13-21/h1-15,23-25,27-28H,16-19H2/t23-,24-/m0/s1 |
| InChIKey | AWZWUYCRFBOWMD-ZEQRLZLVSA-N |
| XLogP | 5.15 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.64 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|